Difference between revisions of "3-HYDROXY-CISCIS-MUCONATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * inchi key: ** InChIKey=DAJDH...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15130 RXN-15130] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15130 RXN-15130] ==
−
* smiles:
+
* direction:
−
** CC1(=C(OC(C1)=O)CC([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/4.4.1.1 EC-4.4.1.1]
−
* common name:
+
−
** 4-methyl-3-oxoadipate-enol-lactone
+
−
* molecular weight:
+
−
** 155.13   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10083]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[L-CYSTATHIONINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[CYS]][c] '''+''' 1 [[2-OXOBUTANOATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-cystathionine[c] '''+''' 1 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 L-cysteine[c] '''+''' 1 2-oxobutanoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3732]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123582 44123582]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01001 R01001]
−
{{#set: smiles=CC1(=C(OC(C1)=O)CC([O-])=O)}}
+
* UNIPROT:
−
{{#set: inchi key=InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M}}
+
** [http://www.uniprot.org/uniprot/P21357 P21357]
−
{{#set: common name=4-methyl-3-oxoadipate-enol-lactone}}
+
** [http://www.uniprot.org/uniprot/P18757 P18757]
−
{{#set: molecular weight=155.13    }}
+
** [http://www.uniprot.org/uniprot/P32929 P32929]
−
{{#set: consumed by=RXN-10083}}
+
** [http://www.uniprot.org/uniprot/P31373 P31373]
 +
** [http://www.uniprot.org/uniprot/Q47847 Q47847]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: ec number=EC-4.4.1.1}}
 +
{{#set: gene associated=Tiso_gene_3732}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=esiliculosus}}

Revision as of 17:28, 10 January 2018

Reaction RXN-15130

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-HYDROXY-CISCIS-MUCONATE&oldid=17953"