Difference between revisions of "Long-Chain-Trans-23-Dehydroacyl-CoA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-NADPH-Hemoprotein-Reductases Ox-NADPH-Hemoprotein-Reductases] == * common name: ** an oxidiz...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-NADPH-Hemoprotein-Reductases Ox-NADPH-Hemoprotein-Reductases] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] ==
 +
* smiles:
 +
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
 
* common name:
 
* common name:
** an oxidized [NADPH-hemoprotein reductase]
+
** campesterol
 +
* molecular weight:
 +
** 400.687   
 
* Synonym(s):
 
* Synonym(s):
 +
** cholest 5-en-3-ol, 24-methyl
 +
** ergost-5-en-3β-ol, (24R)-
 +
** (24R)-24-methylcholest-5-en-3β-ol
 +
** 24(R)-methylcholesterol
 +
** campesterin
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-4225]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-181]]
 
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 
* [[RXN66-161]]
 
* [[RXN-8630]]
 
* [[RXN-11057]]
 
* [[RXN-11056]]
 
* [[RXN66-169]]
 
* [[RXN66-146]]
 
* [[RXN66-163]]
 
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
* [[RXN-13064]]
 
* [[RXN-8872]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an oxidized [NADPH-hemoprotein reductase]}}
+
* LIPID_MAPS : LMST01030097
{{#set: produced by=RXN66-181|HEME-OXYGENASE-DECYCLIZING-RXN|RXN66-161|RXN-8630|RXN-11057|RXN-11056|RXN66-169|RXN66-146|RXN66-163|UNSPECIFIC-MONOOXYGENASE-RXN|RXN-13064|RXN-8872}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=173183 173183]
 +
* HMDB : HMDB02869
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01789 C01789]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10469749.html 10469749]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28623 28623]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N}}
 +
{{#set: common name=campesterol}}
 +
{{#set: molecular weight=400.687    }}
 +
{{#set: common name=cholest 5-en-3-ol, 24-methyl|ergost-5-en-3β-ol, (24R)-|(24R)-24-methylcholest-5-en-3β-ol|24(R)-methylcholesterol|campesterin}}
 +
{{#set: consumed by=RXN-4225}}

Revision as of 17:32, 10 January 2018

Metabolite CPD-707

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
  • common name:
    • campesterol
  • molecular weight:
    • 400.687
  • Synonym(s):
    • cholest 5-en-3-ol, 24-methyl
    • ergost-5-en-3β-ol, (24R)-
    • (24R)-24-methylcholest-5-en-3β-ol
    • 24(R)-methylcholesterol
    • campesterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.