Difference between revisions of "CPD-380"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-300 RXN0-300] == * direction: ** LEFT-TO-RIGHT * common name: ** hydroxypyruvate reductase (NA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == |
− | * | + | * smiles: |
− | ** | + | ** C([N+])CCCC([N+])C([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** L-lysine |
− | * | + | * molecular weight: |
− | ** | + | ** 147.197 |
* Synonym(s): | * Synonym(s): | ||
+ | ** K | ||
+ | ** lysine | ||
+ | ** L-lys | ||
+ | ** lys | ||
+ | ** 2,6-diaminohexanoic acid | ||
+ | ** lysine acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RME144]] |
− | + | * [[LYSINE--TRNA-LIGASE-RXN]] | |
− | * | + | * [[LYSDECARBOX-RXN]] |
− | + | * [[1.5.1.8-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[1.5.1.7-RXN]] |
− | + | * [[DIAMINOPIMDECARB-RXN]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * CAS : 56-87-1 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * METABOLIGHTS : MTBLC32551 |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460926 5460926] |
− | {{#set: | + | * HMDB : HMDB00182 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00047 C00047] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5747.html 5747] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32551 32551] | ||
+ | * BIGG : lys__L | ||
+ | * BIGG : 33655 | ||
+ | {{#set: smiles=C([N+])CCCC([N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O}} | ||
+ | {{#set: common name=L-lysine}} | ||
+ | {{#set: molecular weight=147.197 }} | ||
+ | {{#set: common name=K|lysine|L-lys|lys|2,6-diaminohexanoic acid|lysine acid}} | ||
+ | {{#set: consumed by=RME144|LYSINE--TRNA-LIGASE-RXN|LYSDECARBOX-RXN|1.5.1.8-RXN}} | ||
+ | {{#set: produced by=1.5.1.7-RXN|DIAMINOPIMDECARB-RXN}} |
Revision as of 17:36, 10 January 2018
Contents
Metabolite LYS
- smiles:
- C([N+])CCCC([N+])C([O-])=O
- inchi key:
- InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O
- common name:
- L-lysine
- molecular weight:
- 147.197
- Synonym(s):
- K
- lysine
- L-lys
- lys
- 2,6-diaminohexanoic acid
- lysine acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 56-87-1
- METABOLIGHTS : MTBLC32551
- PUBCHEM:
- HMDB : HMDB00182
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : lys__L
- BIGG : 33655
"C([N+])CCCC([N+])C([O-])=O" cannot be used as a page name in this wiki.