Difference between revisions of "Holo-LYS2-peptidyl-carrier-protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == * smiles: ** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4355 RXN1G-4355] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4355 RXN1G-4355] ==
−
* smiles:
+
* direction:
−
** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J
+
** [http://enzyme.expasy.org/EC/6.4.1.3 EC-6.4.1.3]
−
* common name:
+
−
** acryloyl-CoA
+
−
* molecular weight:
+
−
** 817.551   
+
 
* Synonym(s):
 
* Synonym(s):
−
** acrylyl-coenzyme A
 
−
** propenoyl-CoA
 
−
** acrylyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ATP]][c] '''+''' 1 [[HCO3]][c] '''+''' 1 [[CPD1G-277]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[CPD1G-332]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c]
−
* [[PPCOAOm]]
+
* With common name(s):
−
* [[RXN-6383]]
+
** 1 ATP[c] '''+''' 1 hydrogencarbonate[c] '''+''' 1 cerotoyl-CoA[c] '''=>''' 1 phosphate[c] '''+''' 1 2-carboxy-cerotoyl-CoA[c] '''+''' 1 ADP[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_5029]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* CAS : 5776-58-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-6.4.1.3}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266595 45266595]
+
{{#set: gene associated=Tiso_gene_5029}}
−
* HMDB : HMDB02307
+
{{#set: in pathway=PWYG-321}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00894 C00894]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
{{#set: reconstruction source=esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57367 57367]
+
−
* METABOLIGHTS : MTBLC57367
+
−
{{#set: smiles=C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J}}
+
−
{{#set: common name=acryloyl-CoA}}
+
−
{{#set: molecular weight=817.551    }}
+
−
{{#set: common name=acrylyl-coenzyme A|propenoyl-CoA|acrylyl-CoA}}
+
−
{{#set: consumed or produced by=PPCOAOm|RXN-6383}}
+

Revision as of 17:36, 10 January 2018

Reaction RXN1G-4355

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 hydrogencarbonate[c] + 1 cerotoyl-CoA[c] => 1 phosphate[c] + 1 2-carboxy-cerotoyl-CoA[c] + 1 ADP[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Holo-LYS2-peptidyl-carrier-protein&oldid=18605"