Difference between revisions of "RXN-14271"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14271 RXN-14271] == * direction: ** LEFT-TO-RIGHT * common name: ** (S)-3-hydroxypalmitoyl-CoA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * inchi key: ** InChIKey=CCEFMU...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == |
− | * | + | * smiles: |
− | ** | + | ** C=C(C1(CCC2(C(C1)O2)(C)))C |
+ | * inchi key: | ||
+ | ** InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N | ||
* common name: | * common name: | ||
− | ** ( | + | ** (+)-(1S,4R)-limonene-1,2- epoxide |
− | * | + | * molecular weight: |
− | ** | + | ** 152.236 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-9464]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12382524 12382524] |
− | * LIGAND- | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07271 C07271] |
− | + | * HMDB : HMDB35158 | |
− | {{#set: | + | {{#set: smiles=C=C(C1(CCC2(C(C1)O2)(C)))C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N}} |
− | {{#set: | + | {{#set: common name=(+)-(1S,4R)-limonene-1,2- epoxide}} |
− | + | {{#set: molecular weight=152.236 }} | |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-9464}} |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 19:09, 18 March 2018
Contents
Metabolite CPD-10139
- smiles:
- C=C(C1(CCC2(C(C1)O2)(C)))C
- inchi key:
- InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
- common name:
- (+)-(1S,4R)-limonene-1,2- epoxide
- molecular weight:
- 152.236
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links