Difference between revisions of "Tiso gene 18698"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3971 == * left end position: ** 10612 * transcription direction: ** POSITIVE * right end position: ** 15624 * centisome position: ** 67.489...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11395 CPD-11395] == * smiles: ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC=C(C(I)=C2)O)))[N+])([O-])=O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11395 CPD-11395] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC=C(C(I)=C2)O)))[N+])([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CPCJBZABTUOGNM-LBPRGKRZSA-N |
− | * | + | * common name: |
− | ** | + | ** 3,3'-diiodothyronine |
− | * | + | * molecular weight: |
− | ** | + | ** 525.081 |
* Synonym(s): | * Synonym(s): | ||
+ | ** O-(4-hydroxy-3-iodophenyl)-3-iodotyrosine | ||
+ | ** 3,3'-T2 | ||
+ | ** tyrosine, O-(4-hydroxy-3-iodophenyl)-3-iodo- | ||
+ | ** 2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3-iodophenyl]propanoic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10604]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237213 44237213] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45698 45698] |
− | {{#set: | + | * METABOLIGHTS : MTBLC45698 |
+ | * HMDB : HMDB05869 | ||
+ | {{#set: smiles=C(C(CC1(=CC=C(C(=C1)I)OC2(=CC=C(C(I)=C2)O)))[N+])([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=CPCJBZABTUOGNM-LBPRGKRZSA-N}} | ||
+ | {{#set: common name=3,3'-diiodothyronine}} | ||
+ | {{#set: molecular weight=525.081 }} | ||
+ | {{#set: common name=O-(4-hydroxy-3-iodophenyl)-3-iodotyrosine|3,3'-T2|tyrosine, O-(4-hydroxy-3-iodophenyl)-3-iodo-|2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3-iodophenyl]propanoic acid}} | ||
+ | {{#set: produced by=RXN-10604}} |
Revision as of 18:18, 18 March 2018
Contents
Metabolite CPD-11395
- smiles:
- C(C(CC1(=CC=C(C(=C1)I)OC2(=CC=C(C(I)=C2)O)))[N+])([O-])=O
- inchi key:
- InChIKey=CPCJBZABTUOGNM-LBPRGKRZSA-N
- common name:
- 3,3'-diiodothyronine
- molecular weight:
- 525.081
- Synonym(s):
- O-(4-hydroxy-3-iodophenyl)-3-iodotyrosine
- 3,3'-T2
- tyrosine, O-(4-hydroxy-3-iodophenyl)-3-iodo-
- 2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3-iodophenyl]propanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC1(=CC=C(C(=C1)I)OC2(=CC=C(C(I)=C2)O)))[N+])([O-])=O" cannot be used as a page name in this wiki.
"2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3-iodophenyl]propanoic acid" cannot be used as a page name in this wiki.