Difference between revisions of "Tiso gene 2987"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] == * direction: ** LEFT-TO-RIGHT * common name: ** fatty aldehyde dehydrogenas...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** fatty aldehyde dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Odd-Straight-Chain-234-Sat-FALD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[Odd-Straight-Chain-234-Sat-FA]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 an odd numbered straight chain 2,3,4-saturated fatty aldehyde[c] '''+''' 1 H2O[c] '''+''' 1 NAD+[c] '''=>''' 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c] '''+''' 2 H+[c] '''+''' 1 NADH[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | == Pathways == |
+ | * [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388] | ||
+ | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=fatty aldehyde dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.2.1.3}} | |
− | + | {{#set: in pathway=PWY66-388}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:37, 18 March 2018
Contents
Reaction RXN66-476
- direction:
- LEFT-TO-RIGHT
- common name:
- fatty aldehyde dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Odd-Straight-Chain-234-Sat-FALD[c] + 1 WATER[c] + 1 NAD[c] => 1 Odd-Straight-Chain-234-Sat-FA[c] + 2 PROTON[c] + 1 NADH[c]
- With common name(s):
- 1 an odd numbered straight chain 2,3,4-saturated fatty aldehyde[c] + 1 H2O[c] + 1 NAD+[c] => 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c] + 2 H+[c] + 1 NADH[c]
Genes associated with this reaction
Pathways
- PWY66-388, fatty acid α-oxidation III: PWY66-388
- 4 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation