Difference between revisions of "THIAMINE-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] == * smiles: ** C1(=C(C(=O)NC(N1)=O)F) * inchi key: ** InChIKey=GHASVSINZR...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA40or ACOA40or] == * direction: ** LEFT-TO-RIGHT * common name: ** Butanoyl-CoA:oxygen 2-oxidore...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA40or ACOA40or] ==
* smiles:
+
* direction:
** C1(=C(C(=O)NC(N1)=O)F)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 5-fluorouracil
+
** Butanoyl-CoA:oxygen 2-oxidoreductase
* molecular weight:
+
** 130.078   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[FAD]][x] '''+''' 1.0 [[BUTYRYL-COA]][x] '''=>''' 1.0 [[FADH2]][x] '''+''' 1.0 [[CROTONYL-COA]][x]
* [[5FLURAt]]
+
* With common name(s):
 +
** 1.0 FAD[x] '''+''' 1.0 butanoyl-CoA[x] '''=>''' 1.0 FADH2[x] '''+''' 1.0 crotonyl-CoA[x]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18566]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_17967]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_8272]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_16674]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB00544
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=Butanoyl-CoA:oxygen 2-oxidoreductase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3385 3385]
+
{{#set: gene associated=Tiso_gene_18566|Tiso_gene_17967|Tiso_gene_8272|Tiso_gene_16674}}
* HMDB : HMDB14684
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C07649 C07649]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.3268.html 3268]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=46345 46345]
+
{{#set: smiles=C1(=C(C(=O)NC(N1)=O)F)}}
+
{{#set: inchi key=InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N}}
+
{{#set: common name=5-fluorouracil}}
+
{{#set: molecular weight=130.078    }}
+
{{#set: consumed or produced by=5FLURAt}}
+

Revision as of 18:46, 18 March 2018

Reaction ACOA40or

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Butanoyl-CoA:oxygen 2-oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 FAD[x] + 1.0 butanoyl-CoA[x] => 1.0 FADH2[x] + 1.0 crotonyl-CoA[x]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links