Difference between revisions of "BRANCHED-CHAINAMINOTRANSFERILEU-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
(Created page with "Category:Gene == Gene Tiso_gene_13548 == * left end position: ** 4443 * transcription direction: ** POSITIVE * right end position: ** 6153 * centisome position: ** 71.3162...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
+
== Gene Tiso_gene_13548 ==
−
* smiles:
+
* left end position:
−
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
+
** 4443
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-(α-hydroxyethyl)thiamine diphosphate
+
** 6153
−
* molecular weight:
+
* centisome position:
−
** 466.341    
+
** 71.316216    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(α-hydroxyethyl)-TPP
 
−
** 2-(α-hydroxyethyl)-ThPP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12508]]
+
* [[2.4.2.31-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-12583]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[RXN-14037]]
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4443}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6153}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
+
{{#set: centisome position=71.316216   }}
−
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
+
{{#set: reaction associated=2.4.2.31-RXN}}
−
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
+
−
{{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}}
+
−
{{#set: molecular weight=466.341   }}
+
−
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}}
+
−
{{#set: consumed by=RXN-12508}}
+
−
{{#set: produced by=RXN-12583}}
+
−
{{#set: consumed or produced by=RXN-14037}}
+

Revision as of 18:48, 18 March 2018

Gene Tiso_gene_13548

  • left end position:
    • 4443
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6153
  • centisome position:
    • 71.316216
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=BRANCHED-CHAINAMINOTRANSFERILEU-RXN&oldid=26908"