Difference between revisions of "Sialyloligosaccharides"

Revision as of 18:50, 18 March 2018

"CCC(C([O-])=O)C(C(=O)[O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_1350 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] ==
-* left end position:
+* smiles:
-** 33614
+** CCC(C([O-])=O)C(C(=O)[O-])=O
-* transcription direction:
+* inchi key:
-** NEGATIVE
+** InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
-* right end position:
+* common name:
-** 35536
+** 3-ethyl-2-oxosuccinate
-* centisome position:
+* molecular weight:
-** 93.60884
+** 158.11
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[KDO-8PSYNTH-RXN]]
+* [[RXN-18211]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
+* [[RXN-18210]]
-* [[PWY-1269]]
-* [[PWY-7674]]
 == External links  ==
-{{#set: left end position=33614}}
+{{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])=O}}
-{{#set: transcription direction=NEGATIVE}}
+{{#set: inchi key=InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L}}
-{{#set: right end position=35536}}
+{{#set: common name=3-ethyl-2-oxosuccinate}}
-{{#set: centisome position=93.60884    }}
+{{#set: molecular weight=158.11    }}
-{{#set: reaction associated=KDO-8PSYNTH-RXN}}
+{{#set: consumed by=RXN-18211}}
-{{#set: pathway associated=PWY-1269|PWY-7674}}
+{{#set: reversible reaction associated=RXN-18210}}