Difference between revisions of "N-ACETYLNEURAMINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_10591 == * Synonym(s): == Reactions associated == * 6.3.2.25-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10591 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[6.3.2.25-RXN]] |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | + | == Pathways associated == | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=6.3.2.25-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 19:50, 18 March 2018
Gene Tiso_gene_10591
- Synonym(s):