Difference between revisions of "CPD-17046"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Tiso_gene_12533 == * left end position: ** 3857 * transcription direction: ** POSITIVE * right end position: ** 6912 * centisome position: ** 55.7450...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] ==
+
== Gene Tiso_gene_12533 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
+
** 3857
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** β-L-galactose 1-phosphate
+
** 6912
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 55.74505    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXNQT-4142]]
+
* [[GDR]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* [[GDR_nadp]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[GDR_nadp_h]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[GDR_nadp_m]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[GDRh]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[GDRm]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-4081]]
 +
* [[GLUT-REDOX-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3857}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6912}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522]
+
{{#set: centisome position=55.74505    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GDR|GDR_nadp|GDR_nadp_h|GDR_nadp_m|GDRh|GDRm|GLUTATHIONE-REDUCT-NADPH-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926]
+
{{#set: pathway associated=PWY-4081|GLUT-REDOX-PWY}}
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}}
+
−
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}}
+
−
{{#set: common name=β-L-galactose 1-phosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: consumed by=RXNQT-4142}}
+

Revision as of 00:05, 19 March 2018

Gene Tiso_gene_12533

  • left end position:
    • 3857
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6912
  • centisome position:
    • 55.74505
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-17046&oldid=28627"