Difference between revisions of "RXN-10827"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...") |
(Created page with "Category:Gene == Gene Tiso_gene_17894 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-at...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_17894 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[RXN-1224]] | |
| − | * [[RXN- | + | ** [[pantograph]]-[[esiliculosus]] |
| − | == | + | * [[RXN-15117]] |
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-7817]] | ||
| + | * [[PWYQT-4427]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-1224|RXN-15117}} | |
| − | + | {{#set: pathway associated=PWY-7817|PWYQT-4427}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 00:07, 19 March 2018
Gene Tiso_gene_17894
- Synonym(s):
