Difference between revisions of "N-acetyl-D-glucosamine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...")
(Created page with "Category:Gene == Gene Tiso_gene_15599 == * left end position: ** 3461 * transcription direction: ** NEGATIVE * right end position: ** 4735 * centisome position: ** 70.1601...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
+
== Gene Tiso_gene_15599 ==
−
* smiles:
+
* left end position:
−
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 3461
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-oxo-24-ethyl-cholest-5-ene
+
** 4735
−
* molecular weight:
+
* centisome position:
−
** 412.698    
+
** 70.16014    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
−
* [[RXN-12789]]
+
** [[pantograph]]-[[synechocystis]]
−
== Reaction(s) of unknown directionality ==
+
* [[RXNQT-4142]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-2301]]
 +
* [[PWY-882]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3461}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: right end position=4735}}
−
{{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}}
+
{{#set: centisome position=70.16014    }}
−
{{#set: common name=3-oxo-24-ethyl-cholest-5-ene}}
+
{{#set: reaction associated=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXNQT-4142}}
−
{{#set: molecular weight=412.698    }}
+
{{#set: pathway associated=PWY-2301|PWY-882}}
−
{{#set: produced by=RXN-12789}}
+

Revision as of 00:15, 19 March 2018

Gene Tiso_gene_15599

  • left end position:
    • 3461
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4735
  • centisome position:
    • 70.16014
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-acetyl-D-glucosamine&oldid=29449"