Difference between revisions of "Tiso gene 18995"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
−
** L-ascorbate degradation V
+
** 3-oxo-(7Z)-tetradecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
 +
* molecular weight:
 +
** 985.829   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-14:1-Δ7-CoA
 +
** 3-oxo-7-cis-tetradecenoyl-CoA
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''5''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN-17795]]
−
* [[RXN-12440]]
+
== Reaction(s) known to produce the compound ==
−
** 3 associated gene(s):
+
* [[RXN-17794]]
−
*** [[Tiso_gene_15962]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_16028]]
+
−
*** [[Tiso_gene_5435]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-12861]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-12862]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-12870]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-12871]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33090}}
+
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=L-ascorbate degradation V}}
+
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
−
{{#set: reaction found=5}}
+
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
−
{{#set: total reaction=5}}
+
{{#set: molecular weight=985.829    }}
−
{{#set: completion rate=100.0}}
+
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17795}}
 +
{{#set: produced by=RXN-17794}}

Revision as of 14:44, 21 March 2018

Metabolite CPD-19157

  • smiles:
    • CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(7Z)-tetradecenoyl-CoA
  • inchi key:
    • InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
  • molecular weight:
    • 985.829
  • Synonym(s):
    • 3-oxo-14:1-Δ7-CoA
    • 3-oxo-7-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18995&oldid=29864"