Difference between revisions of "PWY-7241"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] == * smiles: ** C1(C=CC(=C(C=1)O)O) * inchi key: ** InChIKey=YCIMNLLNPGFGHC-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-168 RXN66-168] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-168 RXN66-168] ==
* smiles:
+
* direction:
** C1(C=CC(=C(C=1)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** catechol
+
** exostosin_family_protein
* molecular weight:
+
* ec number:
** 110.112   
+
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
 
* Synonym(s):
 
* Synonym(s):
** pyrocatechol
 
** 2-hydroxyphenol
 
** pyrocatechin
 
** 1,2-dihydroxybenzene
 
** 1,2-benzenediol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-3661]]
+
** 1 [[CPD-2742]][c] '''+''' 1 [[UDP-GLUCURONATE]][c] '''=>''' 1 [[CPD-2747]][c] '''+''' 1 [[UDP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[1.3.1.20-RXN]]
+
** 1 cotinine[c] '''+''' 1 UDP-α-D-glucuronate[c] '''=>''' 1 cotinine-glucuronide[c] '''+''' 1 UDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14141]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14140]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221]
 +
** '''5''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 120-80-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* DRUGBANK : DB02232
+
{{#set: common name=exostosin_family_protein}}
* PUBCHEM:
+
{{#set: ec number=EC-2.4.1.17}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=289 289]
+
{{#set: gene associated=Tiso_gene_14141|Tiso_gene_14140}}
* HMDB : HMDB00957
+
{{#set: in pathway=PWY66-221}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00090 C00090]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.chemspider.com/Chemical-Structure.13837760.html 13837760]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18135 18135]
+
* METABOLIGHTS : MTBLC18135
+
{{#set: smiles=C1(C=CC(=C(C=1)O)O)}}
+
{{#set: inchi key=InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N}}
+
{{#set: common name=catechol}}
+
{{#set: molecular weight=110.112    }}
+
{{#set: common name=pyrocatechol|2-hydroxyphenol|pyrocatechin|1,2-dihydroxybenzene|1,2-benzenediol}}
+
{{#set: produced by=RXN-3661}}
+
{{#set: reversible reaction associated=1.3.1.20-RXN}}
+

Revision as of 14:45, 21 March 2018

Reaction RXN66-168

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exostosin_family_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cotinine[c] + 1 UDP-α-D-glucuronate[c] => 1 cotinine-glucuronide[c] + 1 UDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-221, nicotine degradation V: PWY66-221
    • 5 reactions found over 18 reactions in the full pathway

Reconstruction information

External links