Difference between revisions of "PWY-6580"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * inchi key: ** InChIKey=FSQQTNAZHBEJ...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PPCOAOm PPCOAOm] == * direction: ** REVERSIBLE * common name: ** Propanoyl-CoA:(acceptor) 2,3-oxido...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PPCOAOm PPCOAOm] ==
* smiles:
+
* direction:
** C(=CC(=O)[O-])C(N)=O
+
** REVERSIBLE
* inchi key:
+
** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
+
 
* common name:
 
* common name:
** maleamate
+
** Propanoyl-CoA:(acceptor) 2,3-oxidoreductase
* molecular weight:
+
** 114.08   
+
 
* Synonym(s):
 
* Synonym(s):
** maleic acid monoamide
 
** maleamic acid
 
** (Z)-4-amino-4-oxo-but-2-enoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-646]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[FAD]][m] '''+''' 1.0 [[PROPIONYL-COA]][m] '''<=>''' 1.0 [[FADH2]][m] '''+''' 1.0 [[ACRYLYL-COA]][m]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 FAD[m] '''+''' 1.0 propanoyl-CoA[m] '''<=>''' 1.0 FADH2[m] '''+''' 1.0 acryloyl-CoA[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_8272]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 557-24-4
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: common name=Propanoyl-CoA:(acceptor) 2,3-oxidoreductase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391]
+
{{#set: gene associated=Tiso_gene_17967|Tiso_gene_8272}}
* CHEMSPIDER:
+
{{#set: in pathway=}}
** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932]
+
{{#set: reconstruction category=orthology}}
* CHEBI:
+
{{#set: reconstruction source=orthology-creinhardtii}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146]
+
{{#set: reconstruction tool=pantograph}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596]
+
{{#set: smiles=C(=CC(=O)[O-])C(N)=O}}
+
{{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}}
+
{{#set: common name=maleamate}}
+
{{#set: molecular weight=114.08    }}
+
{{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}}
+
{{#set: consumed by=RXN-646}}
+

Revision as of 14:52, 21 March 2018

Reaction PPCOAOm

  • direction:
    • REVERSIBLE
  • common name:
    • Propanoyl-CoA:(acceptor) 2,3-oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 FAD[m] + 1.0 propanoyl-CoA[m] <=> 1.0 FADH2[m] + 1.0 acryloyl-CoA[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links