Difference between revisions of "CPD-11552"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYBENZALDEHYDE 4-HYDROXYBENZALDEHYDE] == * smiles: ** [CH](C1(C=CC(O)=CC=1))=O * inchi k...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-ACP ACYL-ACP] == * common name: ** an acyl-[acyl-carrier protein] * Synonym(s): ** an acyl...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYBENZALDEHYDE 4-HYDROXYBENZALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-ACP ACYL-ACP] ==
* smiles:
+
** [CH](C1(C=CC(O)=CC=1))=O
+
* inchi key:
+
** InChIKey=RGHHSNMVTDWUBI-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 4-hydroxybenzaldehyde
+
** an acyl-[acyl-carrier protein]
* molecular weight:
+
** 122.123   
+
 
* Synonym(s):
 
* Synonym(s):
** p-hydroxybenzaldehyde
+
** an acyl-ACP
 +
** an acyl-[acp]
 +
** CH3(CH2)xCO-S-ACP
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8872]]
+
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13600]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[1.3.1.9-RXN]]
 +
* [[2.3.1.41-RXN]]
 
== External links  ==
 
== External links  ==
* CAS : 123-08-0
+
{{#set: common name=an acyl-[acyl-carrier protein]}}
* DRUGBANK : DB03560
+
{{#set: common name=an acyl-ACP|an acyl-[acp]|CH3(CH2)xCO-S-ACP}}
* PUBCHEM:
+
{{#set: consumed by=1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126 126]
+
{{#set: reversible reaction associated=1.3.1.9-RXN|2.3.1.41-RXN}}
* HMDB : HMDB11718
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00633 C00633]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.123.html 123]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17597 17597]
+
* METABOLIGHTS : MTBLC17597
+
{{#set: smiles=[CH](C1(C=CC(O)=CC=1))=O}}
+
{{#set: inchi key=InChIKey=RGHHSNMVTDWUBI-UHFFFAOYSA-N}}
+
{{#set: common name=4-hydroxybenzaldehyde}}
+
{{#set: molecular weight=122.123    }}
+
{{#set: common name=p-hydroxybenzaldehyde}}
+
{{#set: consumed by=RXN-8872}}
+
{{#set: produced by=RXN-13600}}
+

Revision as of 14:56, 21 March 2018

Metabolite ACYL-ACP

  • common name:
    • an acyl-[acyl-carrier protein]
  • Synonym(s):
    • an acyl-ACP
    • an acyl-[acp]
    • CH3(CH2)xCO-S-ACP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an acyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
"an acyl-[acp" cannot be used as a page name in this wiki.