Difference between revisions of "PWY-5285"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * smiles: ** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14266 RXN-14266] == * direction: ** REVERSIBLE * common name: ** 3-hydroxyisovaleryl-CoA hydrat...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14266 RXN-14266] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyisovaleryl-CoA hydratase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[3-HYDROXY-ISOVALERYL-COA]][c] '''<=>''' 1 [[CPD-1083]][c] '''+''' 1 [[WATER]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 3-hydroxyisovaleryl-CoA[c] '''<=>''' 1 (E)-2-methylcrotonoyl-CoA[c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14257]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6885]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_16145]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5857]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14262]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31082 31082] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04137 R04137] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=REVERSIBLE}} |
− | + | {{#set: common name=3-hydroxyisovaleryl-CoA hydratase}} | |
− | + | {{#set: ec number=EC-4.2.1.17}} | |
− | + | {{#set: gene associated=Tiso_gene_14257|Tiso_gene_6885|Tiso_gene_16145|Tiso_gene_5857|Tiso_gene_14262}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:59, 21 March 2018
Contents
Reaction RXN-14266
- direction:
- REVERSIBLE
- common name:
- 3-hydroxyisovaleryl-CoA hydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-HYDROXY-ISOVALERYL-COA[c] <=> 1 CPD-1083[c] + 1 WATER[c]
- With common name(s):
- 1 3-hydroxyisovaleryl-CoA[c] <=> 1 (E)-2-methylcrotonoyl-CoA[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14257
- Source: orthology-esiliculosus
- Gene: Tiso_gene_6885
- Source: orthology-esiliculosus
- Gene: Tiso_gene_16145
- Source: orthology-esiliculosus
- Gene: Tiso_gene_5857
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14262
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links