Difference between revisions of "Tiso gene 15852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * smiles: ** CSCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=TWAIOPPFLZEXC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6260 PWY-6260] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6260 PWY-6260] ==
−
* smiles:
+
* taxonomic range:
−
** CSCCCCCC(=O)C([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
−
* inchi key:
+
−
** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 7-(methylthio)-2-oxoheptanoate
+
** thyroid hormone metabolism I (via deiodination)
−
* molecular weight:
+
−
** 189.249   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7-(methylthio)-2-oxoheptanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''12''' reactions in the full pathway
−
* [[RXNQT-4168]]
+
* [[RXN-10604]]
−
* [[RXN-18207]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_20481]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12037]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_20481]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[THYROXINE-DEIODINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_20481]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.97.1.11-RXN 1.97.1.11-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10605 RXN-10605]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12030 RXN-12030]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12031 RXN-12031]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12032 RXN-12032]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12033 RXN-12033]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12034 RXN-12034]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12035 RXN-12035]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12036 RXN-12036]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-7742}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184]
+
{{#set: common name=thyroid hormone metabolism I (via deiodination)}}
−
* KNAPSACK : C00007645
+
{{#set: reaction found=3}}
−
{{#set: smiles=CSCCCCCC(=O)C([O-])=O}}
+
{{#set: total reaction=12}}
−
{{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}}
+
{{#set: completion rate=25.0}}
−
{{#set: common name=7-(methylthio)-2-oxoheptanoate}}
+
−
{{#set: molecular weight=189.249    }}
+
−
{{#set: common name=7-(methylthio)-2-oxoheptanoic acid}}
+
−
{{#set: produced by=RXNQT-4168|RXN-18207}}
+

Revision as of 15:00, 21 March 2018

Pathway PWY-6260

  • taxonomic range:
  • common name:
    • thyroid hormone metabolism I (via deiodination)
  • Synonym(s):

Reaction(s) found

3 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15852&oldid=31785"