Difference between revisions of "Tiso gene 20110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-275...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** sphingomyelin metabolism |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''3''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RXN-12339]] | |
| − | * [[RXN- | + | ** 0 associated gene: |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-15211]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-15212]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_12644]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=sphingomyelin metabolism}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:24, 21 March 2018
Pathway PWY3DJ-11281
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- RXN-12339
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15211
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15212
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
