Difference between revisions of "Tiso gene 15903"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MANNONATE D-MANNONATE] == * smiles: ** C(O)C(C(O)C(O)C(C([O-])=O)O)O * common name: ** D-mann...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MANNONATE D-MANNONATE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
+
** C(O)C(C(O)C(O)C(C([O-])=O)O)O
 
* common name:
 
* common name:
** canavanine biosynthesis
+
** D-mannonate
 +
* inchi key:
 +
** InChIKey=RGHNJXZEOKUKBD-MBMOQRBOSA-M
 +
* molecular weight:
 +
** 195.149   
 
* Synonym(s):
 
* Synonym(s):
 +
** mannonate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''4''' reactions in the full pathway
+
* [[MANNONDEHYDRAT-RXN]]
* [[RXN-10]]
+
== Reaction(s) known to produce the compound ==
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_12592]]
+
* [[MANNURONATE-REDUCTASE-RXN]]
** 3 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
* [[RXN-22]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_2485]]
+
** 3 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-25 RXN-25]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9 RXN-9]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-3803}}
+
* PUBCHEM:
{{#set: common name=canavanine biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460054 5460054]
{{#set: reaction found=2}}
+
* CHEMSPIDER:
{{#set: total reaction=4}}
+
** [http://www.chemspider.com/Chemical-Structure.4573735.html 4573735]
{{#set: completion rate=50.0}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17767 17767]
 +
* BIGG : mana
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00514 C00514]
 +
{{#set: smiles=C(O)C(C(O)C(O)C(C([O-])=O)O)O}}
 +
{{#set: common name=D-mannonate}}
 +
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-MBMOQRBOSA-M}}
 +
{{#set: molecular weight=195.149    }}
 +
{{#set: common name=mannonate}}
 +
{{#set: consumed by=MANNONDEHYDRAT-RXN}}
 +
{{#set: reversible reaction associated=MANNURONATE-REDUCTASE-RXN}}

Revision as of 15:26, 21 March 2018

Metabolite D-MANNONATE

  • smiles:
    • C(O)C(C(O)C(O)C(C([O-])=O)O)O
  • common name:
    • D-mannonate
  • inchi key:
    • InChIKey=RGHNJXZEOKUKBD-MBMOQRBOSA-M
  • molecular weight:
    • 195.149
  • Synonym(s):
    • mannonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(C(O)C(O)C(C([O-])=O)O)O" cannot be used as a page name in this wiki.