Difference between revisions of "CPD-13717"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-ACP-REDUCT-NADH-RXN ENOYL-ACP-REDUCT-NADH-RXN] == * direction: ** LEFT-TO-RIGHT * common name...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-ACP-REDUCT-NADH-RXN ENOYL-ACP-REDUCT-NADH-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
 
* common name:
 
* common name:
−
** 2,3,4-saturated-fatty-acid-[acp] reductase
+
** dihydrogeranylgeranyl diphosphate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
 +
* molecular weight:
 +
** 449.44   
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydroGGPP
 +
** dihydrogeranylgeranyl-PP
 +
** dihydrogeranylgeranyl pyrophosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[TRANS-D2-ENOYL-ACP]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Saturated-Fatty-Acyl-ACPs]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-7659]]
−
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a trans-2-enoyl-[acyl-carrier protein][c] '''=>''' 1 NAD+[c] '''+''' 1 a 2,3,4-saturated fatty acyl-[acp][c]
+
* [[RXN-7658]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[FASYN-ELONG-PWY]], fatty acid elongation -- saturated: [http://metacyc.org/META/NEW-IMAGE?object=FASYN-ELONG-PWY FASYN-ELONG-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P16657 P16657]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
−
** [http://www.uniprot.org/uniprot/O24990 O24990]
+
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
−
** [http://www.uniprot.org/uniprot/Q9JSS8 Q9JSS8]
+
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
−
** [http://www.uniprot.org/uniprot/P0A5Y6 P0A5Y6]
+
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
−
** [http://www.uniprot.org/uniprot/O84106 O84106]
+
{{#set: molecular weight=449.44    }}
−
** [http://www.uniprot.org/uniprot/Q9PMQ7 Q9PMQ7]
+
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
−
** [http://www.uniprot.org/uniprot/P07149 P07149]
+
{{#set: reversible reaction associated=RXN-7659|RXN-7658}}
−
** [http://www.uniprot.org/uniprot/P0AEK4 P0AEK4]
+
−
** [http://www.uniprot.org/uniprot/Q51891 Q51891]
+
−
** [http://www.uniprot.org/uniprot/O04945 O04945]
+
−
** [http://www.uniprot.org/uniprot/O04946 O04946]
+
−
** [http://www.uniprot.org/uniprot/O24207 O24207]
+
−
** [http://www.uniprot.org/uniprot/P93062 P93062]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=2,3,4-saturated-fatty-acid-[acp] reductase}}
+
−
{{#set: ec number=EC-1.3.1.9}}
+
−
{{#set: gene associated=Tiso_gene_10778}}
+
−
{{#set: in pathway=FASYN-ELONG-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Revision as of 15:31, 21 March 2018

Metabolite CPD-7002

  • smiles:
    • CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • common name:
    • dihydrogeranylgeranyl diphosphate
  • inchi key:
    • InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
  • molecular weight:
    • 449.44
  • Synonym(s):
    • dihydroGGPP
    • dihydrogeranylgeranyl-PP
    • dihydrogeranylgeranyl pyrophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13717&oldid=34614"