Difference between revisions of "CPD-881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-D-serines Protein-D-serines] == * common name: ** a [protein]-D-serine * Synonym(s): =...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-715 CPD-715] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-D-serines Protein-D-serines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-715 CPD-715] ==
 +
* smiles:
 +
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
** a [protein]-D-serine
+
** 6-deoxoteasterone
 +
* inchi key:
 +
** InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N
 +
* molecular weight:
 +
** 434.701   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxoteasterone
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-775]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-774]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[5.1.1.16-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a [protein]-D-serine}}
+
* LIPID_MAPS : LMST01030120
{{#set: reversible reaction associated=5.1.1.16-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11144580 11144580]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20716 20716]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15799 C15799]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=6-deoxoteasterone}}
 +
{{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N}}
 +
{{#set: molecular weight=434.701    }}
 +
{{#set: common name=deoxoteasterone}}
 +
{{#set: consumed by=RXN-775}}
 +
{{#set: produced by=RXN-774}}

Revision as of 15:54, 21 March 2018

Metabolite CPD-715

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6-deoxoteasterone
  • inchi key:
    • InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N
  • molecular weight:
    • 434.701
  • Synonym(s):
    • deoxoteasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.