Difference between revisions of "PWY-7241"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] == * smiles: ** C1(C=CC(=C(C=1)O)O) * inchi key: ** InChIKey=YCIMNLLNPGFGHC-...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7241 PWY-7241] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7241 PWY-7241] ==
* smiles:
+
* taxonomic range:
** C1(C=CC(=C(C=1)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** catechol
+
** myo-inositol degradation II
* molecular weight:
+
** 110.112   
+
 
* Synonym(s):
 
* Synonym(s):
** pyrocatechol
 
** 2-hydroxyphenol
 
** pyrocatechin
 
** 1,2-dihydroxybenzene
 
** 1,2-benzenediol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''5''' reactions in the full pathway
* [[RXN-3661]]
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[1.3.1.20-RXN]]
+
*** [[Tiso_gene_17306]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14358 RXN-14358]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14359 RXN-14359]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14360 RXN-14360]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14362 RXN-14362]
 
== External links  ==
 
== External links  ==
* CAS : 120-80-9
+
{{#set: taxonomic range=TAX-2}}
* DRUGBANK : DB02232
+
{{#set: common name=myo-inositol degradation II}}
* PUBCHEM:
+
{{#set: reaction found=1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=289 289]
+
{{#set: total reaction=5}}
* HMDB : HMDB00957
+
{{#set: completion rate=20.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00090 C00090]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13837760.html 13837760]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18135 18135]
+
* METABOLIGHTS : MTBLC18135
+
{{#set: smiles=C1(C=CC(=C(C=1)O)O)}}
+
{{#set: inchi key=InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N}}
+
{{#set: common name=catechol}}
+
{{#set: molecular weight=110.112    }}
+
{{#set: common name=pyrocatechol|2-hydroxyphenol|pyrocatechin|1,2-dihydroxybenzene|1,2-benzenediol}}
+
{{#set: produced by=RXN-3661}}
+
{{#set: reversible reaction associated=1.3.1.20-RXN}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-7241

  • taxonomic range:
  • common name:
    • myo-inositol degradation II
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links