Difference between revisions of "Tiso gene 10752"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_10752 == * right end position: ** 4361 * transcription direction: ** NEGATIVE * left end position: ** 45 * centisome position: ** 0.5406704...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10752 == |
− | * | + | * right end position: |
− | ** | + | ** 4361 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 45 |
− | * | + | * centisome position: |
− | ** | + | ** 0.54067045 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[3. | + | * Reaction: [[3.1.26.3-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4361}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=45}} | |
− | + | {{#set: centisome position=0.54067045 }} | |
− | + | {{#set: reaction associated=3.1.26.3-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Gene Tiso_gene_10752
- right end position:
- 4361
- transcription direction:
- NEGATIVE
- left end position:
- 45
- centisome position:
- 0.54067045
- Synonym(s):
Reactions associated
- Reaction: 3.1.26.3-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation