Difference between revisions of "CPD-11670"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN] == * direction: ** LEFT-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * common name...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) |
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxyindole thiazolidine carboxylate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N |
+ | * molecular weight: | ||
+ | ** 278.325 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-hydroxyindole thiazolidine carboxylic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-10779]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=195334 195334] |
− | + | * CHEMSPIDER: | |
− | + | ** [http://www.chemspider.com/Chemical-Structure.169392.html 169392] | |
− | + | {{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}} | |
− | * | + | {{#set: common name=5-hydroxyindole thiazolidine carboxylate}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}} |
− | + | {{#set: molecular weight=278.325 }} | |
− | + | {{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}} | |
− | + | {{#set: reversible reaction associated=RXN-10779}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:09, 21 March 2018
Contents
Metabolite CPD-11670
- smiles:
- C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
- common name:
- 5-hydroxyindole thiazolidine carboxylate
- inchi key:
- InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
- molecular weight:
- 278.325
- Synonym(s):
- 5-hydroxyindole thiazolidine carboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links