Difference between revisions of "RXN-1884"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1884 RXN-1884] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1884 RXN-1884] ==
−
* smiles:
+
* direction:
−
** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L
+
** [http://enzyme.expasy.org/EC/1.1.1.316 EC-1.1.1.316]
−
* common name:
+
−
** α-ribazole 5'-phosphate
+
−
* molecular weight:
+
−
** 356.271   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole
 
−
** DMB-ribose-5'-P
 
−
** α-ribazole-5'-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RIBAZOLEPHOSPHAT-RXN]]
+
* With identifiers:
−
* [[R04594]]
+
** 1 [[NAD]][c] '''+''' 1 [[L-Galactopyranose]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-330]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 L-galactopyranose[c] '''=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 L-galactono-1,4-lactone[c]
−
* [[RXN-16788]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14920]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14624]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18748]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_703]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4219]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C04778 C04778]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31562 31562]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57918 57918]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07675 R07675]
−
* BIGG : 5prdmbz
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.316}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791947 49791947]
+
{{#set: gene associated=Tiso_gene_14920|Tiso_gene_14624|Tiso_gene_18748|Tiso_gene_703|Tiso_gene_4219}}
−
* HMDB : HMDB03882
+
{{#set: in pathway=PWY-882}}
−
{{#set: smiles=CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: common name=α-ribazole 5'-phosphate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=356.271    }}
+
−
{{#set: common name=N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole|DMB-ribose-5'-P|α-ribazole-5'-P}}
+
−
{{#set: consumed by=RIBAZOLEPHOSPHAT-RXN|R04594}}
+
−
{{#set: reversible reaction associated=RXN-16788}}
+

Latest revision as of 19:09, 21 March 2018

Reaction RXN-1884

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 L-galactopyranose[c] => 1 H+[c] + 1 NADH[c] + 1 L-galactono-1,4-lactone[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-882, L-ascorbate biosynthesis I (L-galactose pathway): PWY-882
    • 6 reactions found over 8 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-1884&oldid=39846"