|
|
(4 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPAMINOTRANS-RXN ASPAMINOTRANS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) |
| * common name: | | * common name: |
− | ** aminotransferase | + | ** tryptamine |
− | ** aspartate_aminotransferase | + | * inchi key: |
− | * ec number: | + | ** InChIKey=APJYDQYYACXCRM-UHFFFAOYSA-O |
− | ** [http://enzyme.expasy.org/EC/2.6.1.1 EC-2.6.1.1] | + | * molecular weight: |
| + | ** 161.226 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 3-(2-aminoethyl)indole |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[STRICTOSIDINE-SYNTHASE-RXN]] |
− | ** 1 [[L-ASPARTATE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[OXALACETIC_ACID]][c] '''+''' 1 [[GLT]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 L-aspartate[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 oxaloacetate[c] '''+''' 1 L-glutamate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_17809]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_6815]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | * [[Tiso_gene_17718]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_13538]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_12889]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_15680]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[MALATE-ASPARTATE-SHUTTLE-PWY]], L-aspartate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=MALATE-ASPARTATE-SHUTTLE-PWY MALATE-ASPARTATE-SHUTTLE-PWY]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-7383]], anaerobic energy metabolism (invertebrates, cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7383 PWY-7383]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[ASPARTATE-DEG1-PWY]], L-aspartate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-DEG1-PWY ASPARTATE-DEG1-PWY]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[ASPARTATESYN-PWY]], L-aspartate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATESYN-PWY ASPARTATESYN-PWY]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[GLUTDEG-PWY]], L-glutamate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=GLUTDEG-PWY GLUTDEG-PWY]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
| + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[ASPARAGINE-DEG1-PWY-1]], L-asparagine degradation III (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGINE-DEG1-PWY-1 ASPARAGINE-DEG1-PWY-1]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[creinhardtii]]
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | *** [[athaliana]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 61-54-1 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21824 21824] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3985862 3985862] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00355 R00355] | + | * HMDB : HMDB00303 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q7LZ21 Q7LZ21] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00398 C00398] |
− | ** [http://www.uniprot.org/uniprot/P08906 P08906]
| + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P12343 P12343] | + | ** [http://www.chemspider.com/Chemical-Structure.3205163.html 3205163] |
− | ** [http://www.uniprot.org/uniprot/Q06191 Q06191] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q02635 Q02635]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57887 57887] |
− | ** [http://www.uniprot.org/uniprot/Q60317 Q60317]
| + | * METABOLIGHTS : MTBLC57887 |
− | ** [http://www.uniprot.org/uniprot/O28151 O28151] | + | {{#set: smiles=C([N+])CC2(=CNC1(=C(C=CC=C1)2))}} |
− | ** [http://www.uniprot.org/uniprot/O67781 O67781]
| + | {{#set: common name=tryptamine}} |
− | ** [http://www.uniprot.org/uniprot/P08907 P08907]
| + | {{#set: inchi key=InChIKey=APJYDQYYACXCRM-UHFFFAOYSA-O}} |
− | ** [http://www.uniprot.org/uniprot/P12345 P12345]
| + | {{#set: molecular weight=161.226 }} |
− | ** [http://www.uniprot.org/uniprot/Q9X0Y2 Q9X0Y2]
| + | {{#set: common name=3-(2-aminoethyl)indole}} |
− | ** [http://www.uniprot.org/uniprot/Q9PPF7 Q9PPF7]
| + | {{#set: consumed by=STRICTOSIDINE-SYNTHASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q9JVS3 Q9JVS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53001 P53001]
| + | |
− | ** [http://www.uniprot.org/uniprot/P96847 P96847]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9K0P5 Q9K0P5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X224 Q9X224]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Y9P0 Q9Y9P0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RWP3 Q9RWP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66737 O66737]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28650 O28650]
| + | |
− | ** [http://www.uniprot.org/uniprot/O30304 O30304]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CEK7 Q9CEK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27916 O27916]
| + | |
− | ** [http://www.uniprot.org/uniprot/O05237 O05237]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YE99 Q9YE99]
| + | |
− | ** [http://www.uniprot.org/uniprot/O25383 O25383]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27638 O27638]
| + | |
− | ** [http://www.uniprot.org/uniprot/O96142 O96142]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZLG5 Q9ZLG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00507 P00507]
| + | |
− | ** [http://www.uniprot.org/uniprot/P44425 P44425]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59569 Q59569]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59197 Q59197]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37833 P37833]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48599 O48599]
| + | |
− | ** [http://www.uniprot.org/uniprot/O33822 O33822]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05201 P05201]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05202 P05202]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14909 P14909]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17174 P17174]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33097 P33097]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43057 Q43057]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43305 Q43305]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42794 Q42794]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12344 P12344]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01802 Q01802]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40325 Q40325]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36692 P36692]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28011 P28011]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42391 Q42391]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9L0L5 Q9L0L5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q53951 Q53951]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42803 Q42803]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42425 Q42425]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55128 Q55128]
| + | |
− | ** [http://www.uniprot.org/uniprot/P72859 P72859]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55453 Q55453]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55679 Q55679]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48598 O48598]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42991 Q42991]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46248 P46248]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48548 O48548]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60013 Q60013]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28734 P28734]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q17994 Q17994]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q17983 Q17983]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q22066 Q22066]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q22067 Q22067]
| + | |
− | ** [http://www.uniprot.org/uniprot/O01804 O01804]
| + | |
− | ** [http://www.uniprot.org/uniprot/O54170 O54170]
| + | |
− | ** [http://www.uniprot.org/uniprot/O42652 O42652]
| + | |
− | ** [http://www.uniprot.org/uniprot/O94320 O94320]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46644 P46644]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00504 P00504]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00508 P00508]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00509 P00509]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00505 P00505]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00503 P00503]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00506 P00506]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26563 P26563]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=aminotransferase}}
| + | |
− | {{#set: common name=aspartate_aminotransferase}} | + | |
− | {{#set: ec number=EC-2.6.1.1}} | + | |
− | {{#set: gene associated=Tiso_gene_17809|Tiso_gene_6815|Tiso_gene_17718|Tiso_gene_13538|Tiso_gene_12889|Tiso_gene_15680}} | + | |
− | {{#set: in pathway=PWY-5913|MALATE-ASPARTATE-SHUTTLE-PWY|PWY-7383|ASPARTATE-DEG1-PWY|ASPARTATESYN-PWY|PWY-7117|GLUTDEG-PWY|PWY-7115|ASPARAGINE-DEG1-PWY-1}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=creinhardtii|synechocystis|esiliculosus|athaliana}}
| + | |
− | {{#set: reconstruction category=manual}}
| + | |
− | {{#set: reconstruction source=primary_network}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |