Difference between revisions of "Beta-D-Glucans"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucans Beta-D-Glucans] == * common name: ** a β-D glucan * Synonym(s): == Reactio...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucans Beta-D-Glucans] ==
* smiles:
+
** C(C([O-])=O)NC(C(CS)[N+])=O
+
* inchi key:
+
** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N
+
 
* common name:
 
* common name:
** L-cysteinyl-glycine
+
** a β-D glucan
* molecular weight:
+
** 178.206   
+
 
* Synonym(s):
 
* Synonym(s):
** Cys-Gly
 
** cysteinylglycine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6622]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6601]]
+
* [[3.2.1.6-RXN]]
* [[RXN-12618]]
+
* [[RXN-15856]]
+
* [[RXN-18092]]
+
* [[RXN-9157]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* BIGG : cgly
+
{{#set: common name=a β-D glucan}}
* PUBCHEM:
+
{{#set: produced by=3.2.1.6-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621]
+
* HMDB : HMDB00078
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694]
+
* METABOLIGHTS : MTBLC4047
+
{{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}}
+
{{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}}
+
{{#set: common name=L-cysteinyl-glycine}}
+
{{#set: molecular weight=178.206    }}
+
{{#set: common name=Cys-Gly|cysteinylglycine}}
+
{{#set: consumed by=RXN-6622}}
+
{{#set: produced by=RXN-6601|RXN-12618|RXN-15856|RXN-18092|RXN-9157}}
+

Latest revision as of 19:10, 21 March 2018

Metabolite Beta-D-Glucans

  • common name:
    • a β-D glucan
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links