Difference between revisions of "CPD-12159"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6120 PWY-6120] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == * smiles: ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6120 PWY-6120] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
+
** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** L-tyrosine biosynthesis III
+
** 26,27-dehydrozymosterol
 +
* inchi key:
 +
** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
 +
* molecular weight:
 +
** 382.628   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
* [[RXN-11201]]
** [[CHORISMATEMUT-RXN]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''2''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=CYCLOHEXADIENYL-DEHYDROGENASE-RXN CYCLOHEXADIENYL-DEHYDROGENASE-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE-TRANSAMINE-RXN PREPHENATE-TRANSAMINE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-3193}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-4751}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155]
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}}
{{#set: common name=L-tyrosine biosynthesis III}}
+
{{#set: common name=26,27-dehydrozymosterol}}
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}}
{{#set: reaction not found=2}}
+
{{#set: molecular weight=382.628    }}
 +
{{#set: consumed by=RXN-11201}}

Latest revision as of 19:12, 21 March 2018

Metabolite CPD-12159

  • smiles:
    • CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
  • common name:
    • 26,27-dehydrozymosterol
  • inchi key:
    • InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
  • molecular weight:
    • 382.628
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))" cannot be used as a page name in this wiki.