Difference between revisions of "CPD-12159"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6748 == * Synonym(s): == Reactions associated == * 3.2.1.24-RXN ** pantograph-esiliculosus == Pathways associated == == Extern...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == * smiles: ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_6748 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] ==
 +
* smiles:
 +
** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
 +
* common name:
 +
** 26,27-dehydrozymosterol
 +
* inchi key:
 +
** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
 +
* molecular weight:
 +
** 382.628   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.2.1.24-RXN]]
+
* [[RXN-11201]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.2.1.24-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155]
 +
{{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}}
 +
{{#set: common name=26,27-dehydrozymosterol}}
 +
{{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}}
 +
{{#set: molecular weight=382.628    }}
 +
{{#set: consumed by=RXN-11201}}

Latest revision as of 19:12, 21 March 2018

Metabolite CPD-12159

  • smiles:
    • CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
  • common name:
    • 26,27-dehydrozymosterol
  • inchi key:
    • InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
  • molecular weight:
    • 382.628
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))" cannot be used as a page name in this wiki.