Difference between revisions of "MALEAMATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PPCOAOm PPCOAOm] == * direction: ** REVERSIBLE * common name: ** Propanoyl-CoA:(acceptor) 2,3-oxido...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * common name: ** maleamate * inchi k...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PPCOAOm PPCOAOm] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(=CC(=O)[O-])C(N)=O
 
* common name:
 
* common name:
−
** Propanoyl-CoA:(acceptor) 2,3-oxidoreductase
+
** maleamate
 +
* inchi key:
 +
** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
 +
* molecular weight:
 +
** 114.08   
 
* Synonym(s):
 
* Synonym(s):
 +
** maleic acid monoamide
 +
** maleamic acid
 +
** (Z)-4-amino-4-oxo-but-2-enoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-646]]
−
** 1.0 [[FAD]][m] '''+''' 1.0 [[PROPIONYL-COA]][m] '''<=>''' 1.0 [[FADH2]][m] '''+''' 1.0 [[ACRYLYL-COA]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 FAD[m] '''+''' 1.0 propanoyl-CoA[m] '''<=>''' 1.0 FADH2[m] '''+''' 1.0 acryloyl-CoA[m]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_17967]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_8272]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* CAS : 557-24-4
−
{{#set: common name=Propanoyl-CoA:(acceptor) 2,3-oxidoreductase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_17967|Tiso_gene_8272}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391]
−
{{#set: in pathway=}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596]
 +
{{#set: smiles=C(=CC(=O)[O-])C(N)=O}}
 +
{{#set: common name=maleamate}}
 +
{{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}}
 +
{{#set: molecular weight=114.08    }}
 +
{{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}}
 +
{{#set: consumed by=RXN-646}}

Latest revision as of 19:14, 21 March 2018

Metabolite MALEAMATE

  • smiles:
    • C(=CC(=O)[O-])C(N)=O
  • common name:
    • maleamate
  • inchi key:
    • InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
  • molecular weight:
    • 114.08
  • Synonym(s):
    • maleic acid monoamide
    • maleamic acid
    • (Z)-4-amino-4-oxo-but-2-enoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=CC(=O)[O-])C(N)=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MALEAMATE&oldid=40379"