Difference between revisions of "MALEAMATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5526 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** in-silico_annotation ***ec-number == Pathways associated == == Extern...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * common name: ** maleamate * inchi k...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5526 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] ==
 +
* smiles:
 +
** C(=CC(=O)[O-])C(N)=O
 +
* common name:
 +
** maleamate
 +
* inchi key:
 +
** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
 +
* molecular weight:
 +
** 114.08   
 
* Synonym(s):
 
* Synonym(s):
 +
** maleic acid monoamide
 +
** maleamic acid
 +
** (Z)-4-amino-4-oxo-but-2-enoate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
* [[RXN-646]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=ATPASE-RXN}}
+
* CAS : 557-24-4
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596]
 +
{{#set: smiles=C(=CC(=O)[O-])C(N)=O}}
 +
{{#set: common name=maleamate}}
 +
{{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}}
 +
{{#set: molecular weight=114.08    }}
 +
{{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}}
 +
{{#set: consumed by=RXN-646}}

Latest revision as of 19:14, 21 March 2018

Metabolite MALEAMATE

  • smiles:
    • C(=CC(=O)[O-])C(N)=O
  • common name:
    • maleamate
  • inchi key:
    • InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
  • molecular weight:
    • 114.08
  • Synonym(s):
    • maleic acid monoamide
    • maleamic acid
    • (Z)-4-amino-4-oxo-but-2-enoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=CC(=O)[O-])C(N)=O" cannot be used as a page name in this wiki.