Difference between revisions of "PWY-6700"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6700 PWY-6700] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6700 PWY-6700] ==
* smiles:
+
* taxonomic range:
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** bisorganyltrisulfane
+
** queuosine biosynthesis
* molecular weight:
+
** 644.686   
+
 
* Synonym(s):
 
* Synonym(s):
** GS3G
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN0-1321]]
* [[RXN-10851]]
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_18857]]
 +
*** [[Tiso_gene_17]]
 +
*** [[Tiso_gene_12326]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-1342]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6037]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12104 RXN-12104]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4022 RXN0-4022]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6700 PWY-6700]
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: common name=queuosine biosynthesis}}
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: reaction found=2}}
{{#set: molecular weight=644.686    }}
+
{{#set: total reaction=4}}
{{#set: common name=GS3G}}
+
{{#set: completion rate=50.0}}
{{#set: consumed or produced by=RXN-10851}}
+

Latest revision as of 19:16, 21 March 2018

Pathway PWY-6700

  • taxonomic range:
  • common name:
    • queuosine biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links