Difference between revisions of "Tiso gene 15093"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] == * smiles: ** C(C(CC(C(C([O-])=O)O)O)=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15093 == * right end position: ** 2894 * transcription direction: ** POSITIVE * left end position: ** 20 * centisome position: ** 0.3818251...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] ==
+
== Gene Tiso_gene_15093 ==
−
* smiles:
+
* right end position:
−
** C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O
+
** 2894
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (2S,3S)-2,3-dihydroxy-5-oxohexanedioate
+
** 20
−
* molecular weight:
+
* centisome position:
−
** 190.109    
+
** 0.38182512    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-deoxy-L-allo-hex-2-ulosarate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[6.3.2.25-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[4.1.2.20-RXN]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2894}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245202 25245202]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=20}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58098 58098]
+
{{#set: centisome position=0.38182512   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03921 C03921]
+
−
{{#set: smiles=C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L}}
+
−
{{#set: common name=(2S,3S)-2,3-dihydroxy-5-oxohexanedioate}}
+
−
{{#set: molecular weight=190.109   }}
+
−
{{#set: common name=3-deoxy-L-allo-hex-2-ulosarate}}
+
−
{{#set: consumed or produced by=4.1.2.20-RXN}}
+

Latest revision as of 19:16, 21 March 2018

Gene Tiso_gene_15093

  • right end position:
    • 2894
  • transcription direction:
    • POSITIVE
  • left end position:
    • 20
  • centisome position:
    • 0.38182512
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15093&oldid=40557"