Difference between revisions of "CPD-11552"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7312 PWY-7312] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-543 TAX-543...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * common name: *...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) |
* common name: | * common name: | ||
| − | ** | + | ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate |
| + | * inchi key: | ||
| + | ** InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 222.177 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-10721]] | |
| − | == Reaction(s) | + | |
| − | * | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145116 21145116] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: reaction | + | ** [http://www.chemspider.com/Chemical-Structure.20016009.html 20016009] |
| + | * HMDB : HMDB04083 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05645 C05645] | ||
| + | {{#set: smiles=C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)}} | ||
| + | {{#set: common name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}} | ||
| + | {{#set: inchi key=InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=222.177 }} | ||
| + | {{#set: reversible reaction associated=RXN-10721}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-11552
- smiles:
- C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
- common name:
- 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
- inchi key:
- InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
- molecular weight:
- 222.177
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)" cannot be used as a page name in this wiki.
