Difference between revisions of "CPD-11552"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-ACP ACYL-ACP] == * common name: ** an acyl-[acyl-carrier protein] * Synonym(s): ** an acyl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * common name: *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == |
+ | * smiles: | ||
+ | ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) | ||
* common name: | * common name: | ||
− | ** | + | ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate |
+ | * inchi key: | ||
+ | ** InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 222.177 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-10721]] |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145116 21145116] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: reversible reaction associated= | + | ** [http://www.chemspider.com/Chemical-Structure.20016009.html 20016009] |
+ | * HMDB : HMDB04083 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05645 C05645] | ||
+ | {{#set: smiles=C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)}} | ||
+ | {{#set: common name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}} | ||
+ | {{#set: inchi key=InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=222.177 }} | ||
+ | {{#set: reversible reaction associated=RXN-10721}} |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-11552
- smiles:
- C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
- common name:
- 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
- inchi key:
- InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
- molecular weight:
- 222.177
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)" cannot be used as a page name in this wiki.