Difference between revisions of "PWY-6268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6268 PWY-6268] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6268 PWY-6268] ==
* smiles:
+
* taxonomic range:
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** cyanidin
+
** adenosylcobalamin salvage from cobalamin
* molecular weight:
+
** 285.232   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
+
** vitamin B12 biosynthesis
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
+
** 3,3',4',5,7-pentahydroxyflavylium
+
** cyanidol
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-9725]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[COBALADENOSYLTRANS-RXN]]
* [[RXN-602]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_6190]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6268 PWY-6268]
* CHEBI:
+
{{#set: taxonomic range=TAX-2157}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
+
{{#set: taxonomic range=TAX-2}}
* LIGAND-CPD:
+
{{#set: common name=adenosylcobalamin salvage from cobalamin}}
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
+
{{#set: common name=vitamin B12 biosynthesis}}
* HMDB : HMDB02708
+
{{#set: reaction found=1}}
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
+
{{#set: total reaction=1}}
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
+
{{#set: completion rate=100.0}}
{{#set: common name=cyanidin}}
+
{{#set: molecular weight=285.232    }}
+
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
+
{{#set: consumed by=RXN-9725}}
+
{{#set: produced by=RXN-602}}
+

Latest revision as of 20:22, 21 March 2018

Pathway PWY-6268

  • taxonomic range:
  • common name:
    • adenosylcobalamin salvage from cobalamin
  • Synonym(s):
    • vitamin B12 biosynthesis

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links