Difference between revisions of "CPDQT-28"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-113 RXN-113] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * smiles: ** CSCCCCCC(=O)C([O-])=O * common name: ** 7-(methylthio)-2-oxo...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-113 RXN-113] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCC(=O)C([O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
+
** 7-(methylthio)-2-oxoheptanoate
 +
* inchi key:
 +
** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 189.249   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-(methylthio)-2-oxoheptanoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD1F-140]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[CPD-236]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[RXNQT-4168]]
−
* With common name(s):
+
* [[RXN-18207]]
−
** 1 gibberellin A20[c] '''+''' 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 succinate[c] '''+''' 1 gibberellin A29[c] '''+''' 1 CO2[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3330]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102]
+
−
** '''4''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03809 R03809]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* KNAPSACK : C00007645
−
{{#set: ec number=EC-1.14.11}}
+
{{#set: smiles=CSCCCCCC(=O)C([O-])=O}}
−
{{#set: gene associated=Tiso_gene_3330}}
+
{{#set: common name=7-(methylthio)-2-oxoheptanoate}}
−
{{#set: in pathway=PWY-102}}
+
{{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=189.249    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=7-(methylthio)-2-oxoheptanoic acid}}
−
{{#set: reconstruction source=athaliana|esiliculosus}}
+
{{#set: produced by=RXNQT-4168|RXN-18207}}

Latest revision as of 19:23, 21 March 2018

Metabolite CPDQT-28

  • smiles:
    • CSCCCCCC(=O)C([O-])=O
  • common name:
    • 7-(methylthio)-2-oxoheptanoate
  • inchi key:
    • InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
  • molecular weight:
    • 189.249
  • Synonym(s):
    • 7-(methylthio)-2-oxoheptanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007645
"CSCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPDQT-28&oldid=41276"