Difference between revisions of "CPD-11752"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10771 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** pantograph-athaliana == Pathways associated == == External l...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] == * smiles: ** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] == |
+ | * smiles: | ||
+ | ** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl))) | ||
+ | * common name: | ||
+ | ** rebeccamycin | ||
+ | * inchi key: | ||
+ | ** InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N | ||
+ | * molecular weight: | ||
+ | ** 570.385 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10847]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C19701 C19701] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.65891.html 65891] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=135511 135511] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=73110 73110] | ||
+ | {{#set: smiles=COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))}} | ||
+ | {{#set: common name=rebeccamycin}} | ||
+ | {{#set: inchi key=InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N}} | ||
+ | {{#set: molecular weight=570.385 }} | ||
+ | {{#set: produced by=RXN-10847}} |
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPD-11752
- smiles:
- COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))
- common name:
- rebeccamycin
- inchi key:
- InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N
- molecular weight:
- 570.385
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links