Difference between revisions of "DUDP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N3-methyluracil1498 16S-rRNA-N3-methyluracil1498] == * common name: ** an N3-methylura...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * c...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) | ||
* common name: | * common name: | ||
| − | ** | + | ** dUDP |
| + | * inchi key: | ||
| + | ** InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K | ||
| + | * molecular weight: | ||
| + | ** 385.14 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2'-deoxyuridine-5'-diphosphate | ||
| + | ** deoxyuridine-diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14220]] | ||
| + | * [[ATDUDm]] | ||
| + | * [[ATDUD]] | ||
| + | * [[DUDPKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN0-722]] |
| + | * [[RXN-14219]] | ||
| + | * [[UDPREDUCT-RXN]] | ||
| + | * [[DUTUP]] | ||
| + | * [[DUTCP]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * BIGG : dudp |
| − | {{#set: produced by=RXN- | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246037 25246037] | ||
| + | * HMDB : HMDB01000 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01346 C01346] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60471 60471] | ||
| + | * METABOLIGHTS : MTBLC60471 | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}} | ||
| + | {{#set: common name=dUDP}} | ||
| + | {{#set: inchi key=InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K}} | ||
| + | {{#set: molecular weight=385.14 }} | ||
| + | {{#set: common name=2'-deoxyuridine-5'-diphosphate|deoxyuridine-diphosphate}} | ||
| + | {{#set: consumed by=RXN-14220|ATDUDm|ATDUD|DUDPKIN-RXN}} | ||
| + | {{#set: produced by=RXN0-722|RXN-14219|UDPREDUCT-RXN|DUTUP|DUTCP}} | ||
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite DUDP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
- common name:
- dUDP
- inchi key:
- InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K
- molecular weight:
- 385.14
- Synonym(s):
- 2'-deoxyuridine-5'-diphosphate
- deoxyuridine-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : dudp
- PUBCHEM:
- HMDB : HMDB01000
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC60471
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.
