Difference between revisions of "CPD-10055"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETALD ACETALD] == * smiles: ** C[CH]=O * inchi key: ** InChIKey=IKHGUXGNUITLKF-UHFFFAOYSA-N *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * common name: ** (1R,2R,4S)-lim...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C=C(C1(CC(C(CC1)(O)C)O))C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (1R,2R,4S)-limonene-1,2-diol |
| + | * inchi key: | ||
| + | ** InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 170.251 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (1S,2S,4R)-menth-8-ene-1,2-diol |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9413]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19082 C19082] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.9392549.html 9392549] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50244 50244] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles=C | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11217495 11217495] |
| − | {{#set: | + | {{#set: smiles=C=C(C1(CC(C(CC1)(O)C)O))C}} |
| − | {{#set: | + | {{#set: common name=(1R,2R,4S)-limonene-1,2-diol}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N}} |
| − | {{#set: common name= | + | {{#set: molecular weight=170.251 }} |
| − | + | {{#set: common name=(1S,2S,4R)-menth-8-ene-1,2-diol}} | |
| − | + | {{#set: produced by=RXN-9413}} | |
| − | {{#set: | + | |
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-10055
- smiles:
- C=C(C1(CC(C(CC1)(O)C)O))C
- common name:
- (1R,2R,4S)-limonene-1,2-diol
- inchi key:
- InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N
- molecular weight:
- 170.251
- Synonym(s):
- (1S,2S,4R)-menth-8-ene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
