Difference between revisions of "L-GLN-FRUCT-6-P-AMINOTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * common nam...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-GLN-FRUCT-6-P-AMINOTRANS-RXN L-GLN-FRUCT-6-P-AMINOTRANS-RXN] == * direction: ** REVERSIBLE * comm...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-GLN-FRUCT-6-P-AMINOTRANS-RXN L-GLN-FRUCT-6-P-AMINOTRANS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
− | ** | + | ** glutamine--fructose-6-phosphate_aminotransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.6.1.16 EC-2.6.1.16] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[GLN]][c] '''<=>''' 1 [[D-GLUCOSAMINE-6-P]][c] '''+''' 1 [[GLT]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 β-D-fructofuranose 6-phosphate[c] '''+''' 1 L-glutamine[c] '''<=>''' 1 D-glucosamine 6-phosphate[c] '''+''' 1 L-glutamate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9051]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[UDPNACETYLGALSYN-PWY]], UDP-N-acetyl-D-glucosamine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=UDPNACETYLGALSYN-PWY UDPNACETYLGALSYN-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6749]], CMP-legionaminate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6749 PWY-6749] | ||
+ | ** '''1''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[UDPNAGSYN-PWY]], UDP-N-acetyl-D-glucosamine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=UDPNAGSYN-PWY UDPNAGSYN-PWY] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13237 13237] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00768 R00768] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q06210 Q06210] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9RXK9 Q9RXK9] |
− | * | + | ** [http://www.uniprot.org/uniprot/P39754 P39754] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P0A588 P0A588] |
− | * | + | ** [http://www.uniprot.org/uniprot/O84823 O84823] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9WXZ5 Q9WXZ5] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9K1P9 Q9K1P9] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9Z6U0 Q9Z6U0] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PLA4 Q9PLA4] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58815 Q58815] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PMT4 Q9PMT4] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P44708 P44708] |
+ | ** [http://www.uniprot.org/uniprot/O26060 O26060] | ||
+ | ** [http://www.uniprot.org/uniprot/O66648 O66648] | ||
+ | ** [http://www.uniprot.org/uniprot/O83833 O83833] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9V249 Q9V249] | ||
+ | ** [http://www.uniprot.org/uniprot/O26273 O26273] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZJ94 Q9ZJ94] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JWN9 Q9JWN9] | ||
+ | ** [http://www.uniprot.org/uniprot/P47856 P47856] | ||
+ | ** [http://www.uniprot.org/uniprot/P53704 P53704] | ||
+ | ** [http://www.uniprot.org/uniprot/Q56206 Q56206] | ||
+ | ** [http://www.uniprot.org/uniprot/P08633 P08633] | ||
+ | ** [http://www.uniprot.org/uniprot/P25195 P25195] | ||
+ | ** [http://www.uniprot.org/uniprot/P40831 P40831] | ||
+ | ** [http://www.uniprot.org/uniprot/P72720 P72720] | ||
+ | ** [http://www.uniprot.org/uniprot/Q09740 Q09740] | ||
+ | ** [http://www.uniprot.org/uniprot/O19908 O19908] | ||
+ | ** [http://www.uniprot.org/uniprot/Q84421 Q84421] | ||
+ | ** [http://www.uniprot.org/uniprot/Q19130 Q19130] | ||
+ | ** [http://www.uniprot.org/uniprot/Q19699 Q19699] | ||
+ | ** [http://www.uniprot.org/uniprot/O86781 O86781] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S168 Q9S168] | ||
+ | ** [http://www.uniprot.org/uniprot/Q56275 Q56275] | ||
+ | ** [http://www.uniprot.org/uniprot/P14742 P14742] | ||
+ | ** [http://www.uniprot.org/uniprot/P17169 P17169] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=glutamine--fructose-6-phosphate_aminotransferase}} | ||
+ | {{#set: ec number=EC-2.6.1.16}} | ||
+ | {{#set: gene associated=Tiso_gene_9051}} | ||
+ | {{#set: in pathway=UDPNACETYLGALSYN-PWY|PWY-6749|UDPNAGSYN-PWY}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-creinhardtii|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:37, 21 March 2018
Contents
Reaction L-GLN-FRUCT-6-P-AMINOTRANS-RXN
- direction:
- REVERSIBLE
- common name:
- glutamine--fructose-6-phosphate_aminotransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FRUCTOSE-6P[c] + 1 GLN[c] <=> 1 D-GLUCOSAMINE-6-P[c] + 1 GLT[c]
- With common name(s):
- 1 β-D-fructofuranose 6-phosphate[c] + 1 L-glutamine[c] <=> 1 D-glucosamine 6-phosphate[c] + 1 L-glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9051
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways
- UDPNACETYLGALSYN-PWY, UDP-N-acetyl-D-glucosamine biosynthesis II: UDPNACETYLGALSYN-PWY
- 4 reactions found over 4 reactions in the full pathway
- PWY-6749, CMP-legionaminate biosynthesis I: PWY-6749
- 1 reactions found over 10 reactions in the full pathway
- UDPNAGSYN-PWY, UDP-N-acetyl-D-glucosamine biosynthesis I: UDPNAGSYN-PWY
- 3 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: