Difference between revisions of "CARNOSINE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5194 PWY-5194] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183980 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * smiles: ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] * common name: ** c...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] |
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** carnosine |
| + | * inchi key: | ||
| + | ** InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N | ||
| + | * molecular weight: | ||
| + | ** 226.235 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ignotine | ||
| + | ** N-β-alanyl-L-histidine | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[CARNOSINE-SYNTHASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00386 C00386] |
| − | + | * HMDB : HMDB00033 | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57485 57485] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC15727 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992100 6992100] |
| − | {{#set: | + | {{#set: smiles=C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+]}} |
| + | {{#set: common name=carnosine}} | ||
| + | {{#set: inchi key=InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N}} | ||
| + | {{#set: molecular weight=226.235 }} | ||
| + | {{#set: common name=ignotine|N-β-alanyl-L-histidine}} | ||
| + | {{#set: produced by=CARNOSINE-SYNTHASE-RXN}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite CARNOSINE
- smiles:
- C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+]
- common name:
- carnosine
- inchi key:
- InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N
- molecular weight:
- 226.235
- Synonym(s):
- ignotine
- N-β-alanyl-L-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+" cannot be used as a page name in this wiki.
