Difference between revisions of "ECOAH8"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] == * smiles: ** C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ECOAH8 ECOAH8] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-CoA dehydratase (18...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ECOAH8 ECOAH8] ==
−
* smiles:
+
* direction:
−
** C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XBQYQXVJBNDCGY-LBPRGKRZSA-M
+
 
* common name:
 
* common name:
−
** triiodothyronine sulfate
+
** 3-hydroxyacyl-CoA dehydratase (18:1(2E))
−
* molecular weight:
+
−
** 730.028   
+
 
* Synonym(s):
 
* Synonym(s):
−
** triiodothyronine sulfuric ester
 
−
** 3,3',5-triiodo-L-thyronine sulfate
 
−
** 3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine
 
−
** L-tyrosine, 3,5-diiodo-O-(3-iodo-4-(sulfooxy)phenyl)-
 
−
** (2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10615]]
+
** 1.0 [[CPD0-2253]][c] '''=>''' 1.0 [[CPD-10262]][c] '''+''' 1.0 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 (S)-3-hydroxy-stearoyl-CoA[c] '''=>''' 1.0 trans-octadec-2-enoyl-CoA[c] '''+''' 1.0 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6885]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657986 90657986]
+
{{#set: common name=3-hydroxyacyl-CoA dehydratase (18:1(2E))}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_6885}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35432 35432]
+
{{#set: in pathway=}}
−
* METABOLIGHTS : MTBLC35432
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB03036
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=XBQYQXVJBNDCGY-LBPRGKRZSA-M}}
+
−
{{#set: common name=triiodothyronine sulfate}}
+
−
{{#set: molecular weight=730.028    }}
+
−
{{#set: common name=triiodothyronine sulfuric ester|3,3',5-triiodo-L-thyronine sulfate|3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine|L-tyrosine, 3,5-diiodo-O-(3-iodo-4-(sulfooxy)phenyl)-|(2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid}}
+
−
{{#set: produced by=RXN-10615}}
+

Latest revision as of 19:38, 21 March 2018

Reaction ECOAH8

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-CoA dehydratase (18:1(2E))
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 (S)-3-hydroxy-stearoyl-CoA[c] => 1.0 trans-octadec-2-enoyl-CoA[c] + 1.0 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ECOAH8&oldid=42858"