Difference between revisions of "IMINOASPARTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == * smiles: ** C([O-])(=O)C1(CC1)[N+] * inchi key: ** InChIKey=PAJPWUMXBYXFCZ-U...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * common name: ** 2-i...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == |
* smiles: | * smiles: | ||
− | ** C([O-])(= | + | ** C(=O)([O-])CC(=N)C(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-iminosuccinate |
+ | * inchi key: | ||
+ | ** InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 129.072 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-iminobutanedioate |
− | ** | + | ** α-iminosuccinate |
− | + | ** iminoaspartate | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[L-ASPARTATE-OXID-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615393 23615393] |
− | * HMDB : | + | * HMDB : HMDB01131 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05840 C05840] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19951415.html 19951415] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58831 58831] |
− | * | + | * BIGG : iasp |
− | {{#set: smiles=C([O-])(= | + | {{#set: smiles=C(=O)([O-])CC(=N)C(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=2-iminosuccinate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=129.072 }} |
− | {{#set: common name= | + | {{#set: common name=2-iminobutanedioate|α-iminosuccinate|iminoaspartate}} |
− | {{#set: | + | {{#set: produced by=L-ASPARTATE-OXID-RXN}} |
− | + |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite IMINOASPARTATE
- smiles:
- C(=O)([O-])CC(=N)C(=O)[O-]
- common name:
- 2-iminosuccinate
- inchi key:
- InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L
- molecular weight:
- 129.072
- Synonym(s):
- 2-iminobutanedioate
- α-iminosuccinate
- iminoaspartate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CC(=N)C(=O)[O-" cannot be used as a page name in this wiki.