Difference between revisions of "Tiso gene 16889"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == * smiles: ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_16889 == * right end position: ** 4037 * transcription direction: ** POSITIVE * left end position: ** 625 * centisome position: ** 15.39029...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16889 == |
− | * | + | * right end position: |
− | ** | + | ** 4037 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 625 |
− | * | + | * centisome position: |
− | ** | + | ** 15.390298 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NITRATE-REDUCTASE-NADH-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-381]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4037}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=625}} | |
− | + | {{#set: centisome position=15.390298 }} | |
− | + | {{#set: reaction associated=NITRATE-REDUCTASE-NADH-RXN}} | |
− | + | {{#set: pathway associated=PWY-381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Gene Tiso_gene_16889
- right end position:
- 4037
- transcription direction:
- POSITIVE
- left end position:
- 625
- centisome position:
- 15.390298
- Synonym(s):
Reactions associated
- Reaction: NITRATE-REDUCTASE-NADH-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation