Difference between revisions of "Glucuronosylated-Glucuronoside-Acceptors"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Adenines 3-Methyl-Adenines] == * smiles: ** CN1(C2(=NC=NC(=C(N)N=C1)2)) * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucuronosylated-Glucuronoside-Acceptors Glucuronosylated-Glucuronoside-Acceptors] == * common...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucuronosylated-Glucuronoside-Acceptors Glucuronosylated-Glucuronoside-Acceptors] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a glucuronated glucosyluronate acceptor |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[UDP-GLUCURONOSYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a glucuronated glucosyluronate acceptor}} | |
| − | + | {{#set: produced by=UDP-GLUCURONOSYLTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: produced by= | + | |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite Glucuronosylated-Glucuronoside-Acceptors
- common name:
- a glucuronated glucosyluronate acceptor
- Synonym(s):
