Difference between revisions of "CPD-18118"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9600 RXN-9600] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** D-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9600 RXN-9600] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.4.3.22 EC-1.4.3.22]
+
** D-arabinofuranose 5-phosphate
 +
* inchi key:
 +
** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-arabinofuranose 5P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[KDO-8PSYNTH-RXN]]
−
** 1 [[WATER]][c] '''+''' 1 [[HISTAMINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[IMIDAZOLE_ACETALDEHYDE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 histamine[c] '''+''' 1 oxygen[c] '''=>''' 1 ammonium[c] '''+''' 1 imidazole acetaldehyde[c] '''+''' 1 hydrogen peroxide[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8756]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-6181]], histamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25628 25628]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02150 R02150]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
−
{{#set: ec number=EC-1.4.3.22}}
+
{{#set: common name=D-arabinofuranose 5-phosphate}}
−
{{#set: gene associated=Tiso_gene_8756}}
+
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}}
−
{{#set: in pathway=PWY-6181}}
+
{{#set: molecular weight=228.095    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=D-arabinofuranose 5P}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=KDO-8PSYNTH-RXN}}
−
{{#set: reconstruction source=creinhardtii}}
+

Latest revision as of 20:44, 21 March 2018

Metabolite CPD-18118

  • smiles:
    • C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
  • common name:
    • D-arabinofuranose 5-phosphate
  • inchi key:
    • InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • D-arabinofuranose 5P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-18118&oldid=43521"